About 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine
4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine (PubChem CID 170594613) has the molecular formula C23H25BrN2
and a molecular weight of 409.37 g/mol. Its IUPAC name is 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine.
Molecular Properties
| Compound Name | 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine |
| PubChem CID | 170594613 |
| Molecular Formula | C23H25BrN2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.12 |
| IUPAC Name | 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine |
| SMILES | Cc1ccc(CN(Cc2ccc(C)cc2)c2cc(Br)c(C)c(C)n2)cc1 |
| InChI | InChI=1S/C23H25BrN2/c1-16-5-9-20(10-6-16)14-26(15-21-11-7-17(2)8-12-21)23-13-22(24)18(3)19(4)25-23/h5-13H,14-15H2,1-4H3 |
| InChIKey | CIYKHWKUMMWRAX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine?
The IUPAC name of 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine (CID 170594613) is 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine.
What is the SMILES notation for 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine?
The canonical SMILES for 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine is Cc1ccc(CN(Cc2ccc(C)cc2)c2cc(Br)c(C)c(C)n2)cc1.
What is the InChIKey of 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine?
The InChIKey is CIYKHWKUMMWRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H25BrN2/c1-16-5-9-20(10-6-16)14-26(15-21-11-7-17(2)8-12-21)23-13-22(24)18(3)19(4)25-23/h5-13H,14-15H2,1-4H3.
What are the key properties of 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine?
4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine has a molecular weight of 409.37 g/mol, XLogP of 6.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-5,6-dimethyl-N,N-bis[(4-methylphenyl)methyl]pyridin-2-amine is sourced from PubChem (CID 170594613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).