C25H34N2O2Si — CID 170594879
6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-one (PubChem CID 170594879) has the molecular formula C25H34N2O2Si and a molecular weight of 422.65 g/mol. Its IUPAC name is 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-one.
| Compound Name | 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-one |
|---|---|
| PubChem CID | 170594879 |
| Molecular Formula | C25H34N2O2Si |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.24 |
| IUPAC Name | 6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-methyl-1,4,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-3-one |
| SMILES | CN1CC2CCC(CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)N2CC1=O |
| InChI | InChI=1S/C25H34N2O2Si/c1-25(2,3)30(22-11-7-5-8-12-22,23-13-9-6-10-14-23)29-19-21-16-15-20-17-26(4)24(28)18-27(20)21/h5-14,20-21H,15-19H2,1-4H3 |
| InChIKey | XUBHBFCNWSGKOJ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|