C6H11F2N — CID 170595317
3-(2,2-difluoroethyl)-1-methylazetidine (PubChem CID 170595317) has the molecular formula C6H11F2N and a molecular weight of 135.16 g/mol. Its IUPAC name is 3-(2,2-difluoroethyl)-1-methylazetidine.
| Compound Name | 3-(2,2-difluoroethyl)-1-methylazetidine |
|---|---|
| PubChem CID | 170595317 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 3-(2,2-difluoroethyl)-1-methylazetidine |
| SMILES | CN1CC(CC(F)F)C1 |
| InChI | InChI=1S/C6H11F2N/c1-9-3-5(4-9)2-6(7)8/h5-6H,2-4H2,1H3 |
| InChIKey | UHPTVDSJBQYTHN-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |