C12H17NO — CID 170595636
2,4-dimethyl-4H-cyclohepta[d][1,3]oxazole;ethane (PubChem CID 170595636) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 2,4-dimethyl-4H-cyclohepta[d][1,3]oxazole;ethane.
| Compound Name | 2,4-dimethyl-4H-cyclohepta[d][1,3]oxazole;ethane |
|---|---|
| PubChem CID | 170595636 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 2,4-dimethyl-4H-cyclohepta[d][1,3]oxazole;ethane |
| SMILES | CC.Cc1nc2c(o1)C=CC=CC2C |
| InChI | InChI=1S/C10H11NO.C2H6/c1-7-5-3-4-6-9-10(7)11-8(2)12-9;1-2/h3-7H,1-2H3;1-2H3 |
| InChIKey | GMHMQIZBTRSQTG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |