C34H43N7O12 — CID 170596592
[4-[[5-(carbamoylamino)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate;propane (PubChem CID 170596592) has the molecular formula C34H43N7O12 and a molecular weight of 741.75 g/mol. Its IUPAC name is [4-[[5-(carbamoylamino)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate;propane.
| Compound Name | [4-[[5-(carbamoylamino)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate;propane |
|---|---|
| PubChem CID | 170596592 |
| Molecular Formula | C34H43N7O12 |
| Molecular Weight | 741.75 g/mol |
| Exact Mass | 741.30 |
| IUPAC Name | [4-[[5-(carbamoylamino)-2-[[2-[3-[2-(2,5-dioxopyrrol-1-yl)ethoxy]propanoylamino]acetyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate;propane |
| SMILES | CCC.NC(=O)NCCCC(NC(=O)CNC(=O)CCOCCN1C(=O)C=CC1=O)C(=O)Nc1ccc(COC(=O)Oc2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C31H35N7O12.C3H8/c32-30(44)33-14-1-2-24(36-26(40)18-34-25(39)13-16-48-17-15-37-27(41)11-12-28(37)42)29(43)35-21-5-3-20(4-6-21)19-49-31(45)50-23-9-7-22(8-10-23)38(46)47;1-3-2/h3-12,24H,1-2,13-19H2,(H,34,39)(H,35,43)(H,36,40)(H3,32,33,44);3H2,1-2H3 |
| InChIKey | GCNFISPKCDKPJN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 267.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.75 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|