C47H66BN10O2PS — CID 170596904
CID 170596904 (PubChem CID 170596904) has the molecular formula C47H66BN10O2PS and a molecular weight of 876.97 g/mol.
| Compound Name | CID 170596904 |
|---|---|
| PubChem CID | 170596904 |
| Molecular Formula | C47H66BN10O2PS |
| Molecular Weight | 876.97 g/mol |
| Exact Mass | 876.49 |
| IUPAC Name | — |
| SMILES | [B]P.[H]/N=C1C(=C(C)\C(N)=N\c2nc3ccccc3s2)/CCCN/1C1=CC=C(c2cnn(CC34CC5(C)CC(C)(C3)CC(OCCN3CCCC3)(C5)C4)c2C)/C(=C(\O)NC(C)C)N1 |
| InChI | InChI=1S/C47H64N10O2S.BH2P/c1-30(2)51-42(58)39-34(15-16-38(53-39)56-19-11-12-33(41(56)49)31(3)40(48)54-43-52-36-13-7-8-14-37(36)60-43)35-22-50-57(32(35)4)29-46-24-44(5)23-45(6,25-46)27-47(26-44,28-46)59-21-20-55-17-9-10-18-55;1-2/h7-8,13-16,22,30,49,51,53,58H,9-12,17-21,23-29H2,1-6H3,(H2,48,52,54);2H2/b33-31-,42-39+,49-41-; |
| InChIKey | VHLLLHGGXAZEHC-QBZUDWCLSA-N |
| XLogP | 8.61 |
| TPSA | 152.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.97 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|