C6H14N2S — CID 170597247
3-N,4-N-dimethylthiolane-3,4-diamine (PubChem CID 170597247) has the molecular formula C6H14N2S and a molecular weight of 146.26 g/mol. Its IUPAC name is 3-N,4-N-dimethylthiolane-3,4-diamine.
| Compound Name | 3-N,4-N-dimethylthiolane-3,4-diamine |
|---|---|
| PubChem CID | 170597247 |
| Molecular Formula | C6H14N2S |
| Molecular Weight | 146.26 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 3-N,4-N-dimethylthiolane-3,4-diamine |
| SMILES | CNC1CSCC1NC |
| InChI | InChI=1S/C6H14N2S/c1-7-5-3-9-4-6(5)8-2/h5-8H,3-4H2,1-2H3 |
| InChIKey | QMJOASXLFASOOP-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |