About (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane
(8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane (PubChem CID 170598691) has the molecular formula C14H28F2OS
and a molecular weight of 282.44 g/mol. Its IUPAC name is (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane.
Molecular Properties
| Compound Name | (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane |
| PubChem CID | 170598691 |
| Molecular Formula | C14H28F2OS |
| Molecular Weight | 282.44 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane |
| SMILES | C=C(C=S(C)(C)=O)CCCCCC(C)(F)F.CC |
| InChI | InChI=1S/C12H22F2OS.C2H6/c1-11(10-16(3,4)15)8-6-5-7-9-12(2,13)14;1-2/h10H,1,5-9H2,2-4H3;1-2H3 |
| InChIKey | FOYRQPDBKSZUHV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.44 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane?
The IUPAC name of (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane (CID 170598691) is (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane.
What is the SMILES notation for (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane?
The canonical SMILES for (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane is C=C(C=S(C)(C)=O)CCCCCC(C)(F)F.CC.
What is the InChIKey of (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane?
The InChIKey is FOYRQPDBKSZUHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F2OS.C2H6/c1-11(10-16(3,4)15)8-6-5-7-9-12(2,13)14;1-2/h10H,1,5-9H2,2-4H3;1-2H3.
What are the key properties of (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane?
(8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane has a molecular weight of 282.44 g/mol, XLogP of 4.52, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (8,8-difluoro-2-methylidenenonylidene)-dimethyl-oxo-λ6-sulfane;ethane is sourced from PubChem (CID 170598691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).