C10H14FN3O2S — CID 170598969
(3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-amine (PubChem CID 170598969) has the molecular formula C10H14FN3O2S and a molecular weight of 259.31 g/mol. Its IUPAC name is (3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-amine.
| Compound Name | (3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 170598969 |
| Molecular Formula | C10H14FN3O2S |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (3R,4R)-3-fluoro-1-pyridin-2-ylsulfonylpiperidin-4-amine |
| SMILES | N[C@@H]1CCN(S(=O)(=O)c2ccccn2)C[C@H]1F |
| InChI | InChI=1S/C10H14FN3O2S/c11-8-7-14(6-4-9(8)12)17(15,16)10-3-1-2-5-13-10/h1-3,5,8-9H,4,6-7,12H2/t8-,9-/m1/s1 |
| InChIKey | LMIZGMHQBFBCPN-RKDXNWHRSA-N |
| XLogP | 0.14 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |