About 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine
3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine (PubChem CID 170599459) has the molecular formula C21H46F2N2
and a molecular weight of 364.61 g/mol. Its IUPAC name is 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine |
| PubChem CID | 170599459 |
| Molecular Formula | C21H46F2N2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.36 |
| IUPAC Name | 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine |
| SMILES | CC.CC.CC(C)C1CNCC(F)(F)C1.CC1CCN(C(C)C)CC1 |
| InChI | InChI=1S/C9H19N.C8H15F2N.2C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-6(2)7-3-8(9,10)5-11-4-7;2*1-2/h8-9H,4-7H2,1-3H3;6-7,11H,3-5H2,1-2H3;2*1-2H3 |
| InChIKey | KJFSPVLXQJNXQW-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine?
The IUPAC name of 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine (CID 170599459) is 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine.
What is the SMILES notation for 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine?
The canonical SMILES for 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine is CC.CC.CC(C)C1CNCC(F)(F)C1.CC1CCN(C(C)C)CC1.
What is the InChIKey of 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine?
The InChIKey is KJFSPVLXQJNXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N.C8H15F2N.2C2H6/c1-8(2)10-6-4-9(3)5-7-10;1-6(2)7-3-8(9,10)5-11-4-7;2*1-2/h8-9H,4-7H2,1-3H3;6-7,11H,3-5H2,1-2H3;2*1-2H3.
What are the key properties of 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine?
3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine has a molecular weight of 364.61 g/mol, XLogP of 6.07, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-5-propan-2-ylpiperidine;ethane;4-methyl-1-propan-2-ylpiperidine is sourced from PubChem (CID 170599459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).