About 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane
3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane (PubChem CID 170599656) has the molecular formula C21H44F2N2
and a molecular weight of 362.59 g/mol. Its IUPAC name is 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane.
Molecular Properties
| Compound Name | 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane |
| PubChem CID | 170599656 |
| Molecular Formula | C21H44F2N2 |
| Molecular Weight | 362.59 g/mol |
| Exact Mass | 362.35 |
| IUPAC Name | 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane |
| SMILES | CC.CC(C)C1CCN(C(C)C)CC1.CC(C)C1CNCC(F)(F)C1 |
| InChI | InChI=1S/C11H23N.C8H15F2N.C2H6/c1-9(2)11-5-7-12(8-6-11)10(3)4;1-6(2)7-3-8(9,10)5-11-4-7;1-2/h9-11H,5-8H2,1-4H3;6-7,11H,3-5H2,1-2H3;1-2H3 |
| InChIKey | LYABNNYZQHOQKL-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.59 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane?
The IUPAC name of 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane (CID 170599656) is 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane.
What is the SMILES notation for 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane?
The canonical SMILES for 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane is CC.CC(C)C1CCN(C(C)C)CC1.CC(C)C1CNCC(F)(F)C1.
What is the InChIKey of 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane?
The InChIKey is LYABNNYZQHOQKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N.C8H15F2N.C2H6/c1-9(2)11-5-7-12(8-6-11)10(3)4;1-6(2)7-3-8(9,10)5-11-4-7;1-2/h9-11H,5-8H2,1-4H3;6-7,11H,3-5H2,1-2H3;1-2H3.
What are the key properties of 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane?
3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane has a molecular weight of 362.59 g/mol, XLogP of 5.68, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-5-propan-2-ylpiperidine;1,4-di(propan-2-yl)piperidine;ethane is sourced from PubChem (CID 170599656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).