C14H20F2N2O — CID 170599685
(2Z,3E)-N-(3,3-difluoropiperidin-4-yl)-2-ethylidene-3-methylhexa-3,5-dienamide (PubChem CID 170599685) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is (2Z,3E)-N-(3,3-difluoropiperidin-4-yl)-2-ethylidene-3-methylhexa-3,5-dienamide.
| Compound Name | (2Z,3E)-N-(3,3-difluoropiperidin-4-yl)-2-ethylidene-3-methylhexa-3,5-dienamide |
|---|---|
| PubChem CID | 170599685 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | (2Z,3E)-N-(3,3-difluoropiperidin-4-yl)-2-ethylidene-3-methylhexa-3,5-dienamide |
| SMILES | C=C/C=C(C)/C(=C/C)C(=O)NC1CCNCC1(F)F |
| InChI | InChI=1S/C14H20F2N2O/c1-4-6-10(3)11(5-2)13(19)18-12-7-8-17-9-14(12,15)16/h4-6,12,17H,1,7-9H2,2-3H3,(H,18,19)/b10-6+,11-5- |
| InChIKey | ISRGSXWYGVQAAM-NYHKZRGGSA-N |
| XLogP | 2.18 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|