C17H20BrF3N6O2 — CID 170599880
1-[(Z)-1-aminooxy-2-[(5-bromo-2-pyridinyl)methylamino]ethenyl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea;ethane (PubChem CID 170599880) has the molecular formula C17H20BrF3N6O2 and a molecular weight of 477.29 g/mol. Its IUPAC name is 1-[(Z)-1-aminooxy-2-[(5-bromo-2-pyridinyl)methylamino]ethenyl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea;ethane.
| Compound Name | 1-[(Z)-1-aminooxy-2-[(5-bromo-2-pyridinyl)methylamino]ethenyl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea;ethane |
|---|---|
| PubChem CID | 170599880 |
| Molecular Formula | C17H20BrF3N6O2 |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 476.08 |
| IUPAC Name | 1-[(Z)-1-aminooxy-2-[(5-bromo-2-pyridinyl)methylamino]ethenyl]-3-[5-(trifluoromethyl)-3-pyridinyl]urea;ethane |
| SMILES | CC.NO/C(=C\NCc1ccc(Br)cn1)NC(=O)Nc1cncc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H14BrF3N6O2.C2H6/c16-10-1-2-11(23-5-10)6-22-8-13(27-20)25-14(26)24-12-3-9(4-21-7-12)15(17,18)19;1-2/h1-5,7-8,22H,6,20H2,(H2,24,25,26);1-2H3/b13-8-; |
| InChIKey | XJYCAYUYJXBJAB-MGAWDJABSA-N |
| XLogP | 3.88 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|