About 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol
4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol (PubChem CID 170600576) has the molecular formula C17H12ClI2NO3
and a molecular weight of 567.55 g/mol. Its IUPAC name is 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol.
Molecular Properties
| Compound Name | 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol |
| PubChem CID | 170600576 |
| Molecular Formula | C17H12ClI2NO3 |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 566.86 |
| IUPAC Name | 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol |
| SMILES | CCc1oc2ccc(Cl)cc2c1/C(=N\O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C17H12ClI2NO3/c1-2-13-15(10-7-9(18)3-4-14(10)24-13)16(21-23)8-5-11(19)17(22)12(20)6-8/h3-7,22-23H,2H2,1H3/b21-16- |
| InChIKey | BKLATMFHELQARU-PGMHBOJBSA-N |
| XLogP | 5.79 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol?
The IUPAC name of 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol (CID 170600576) is 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol.
What is the SMILES notation for 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol?
The canonical SMILES for 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol is CCc1oc2ccc(Cl)cc2c1/C(=N\O)c1cc(I)c(O)c(I)c1.
What is the InChIKey of 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol?
The InChIKey is BKLATMFHELQARU-PGMHBOJBSA-N. The full InChI is InChI=1S/C17H12ClI2NO3/c1-2-13-15(10-7-9(18)3-4-14(10)24-13)16(21-23)8-5-11(19)17(22)12(20)6-8/h3-7,22-23H,2H2,1H3/b21-16-.
What are the key properties of 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol?
4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol has a molecular weight of 567.55 g/mol, XLogP of 5.79, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol is sourced from PubChem (CID 170600576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).