C17H12ClI2NO3 — CID 170600576
4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol (PubChem CID 170600576) has the molecular formula C17H12ClI2NO3 and a molecular weight of 567.55 g/mol. Its IUPAC name is 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol.
| Compound Name | 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol |
|---|---|
| PubChem CID | 170600576 |
| Molecular Formula | C17H12ClI2NO3 |
| Molecular Weight | 567.55 g/mol |
| Exact Mass | 566.86 |
| IUPAC Name | 4-[(Z)-C-(5-chloro-2-ethyl-1-benzofuran-3-yl)-N-hydroxycarbonimidoyl]-2,6-diiodophenol |
| SMILES | CCc1oc2ccc(Cl)cc2c1/C(=N\O)c1cc(I)c(O)c(I)c1 |
| InChI | InChI=1S/C17H12ClI2NO3/c1-2-13-15(10-7-9(18)3-4-14(10)24-13)16(21-23)8-5-11(19)17(22)12(20)6-8/h3-7,22-23H,2H2,1H3/b21-16- |
| InChIKey | BKLATMFHELQARU-PGMHBOJBSA-N |
| XLogP | 5.79 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.55 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|