C27H26BN5O4 — CID 170600608
N-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-6-carboxamide (PubChem CID 170600608) has the molecular formula C27H26BN5O4 and a molecular weight of 495.35 g/mol. Its IUPAC name is N-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-6-carboxamide.
| Compound Name | N-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 170600608 |
| Molecular Formula | C27H26BN5O4 |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | N-[[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-benzoxazol-2-yl]phenyl]methyl]imidazo[1,2-a]pyrimidine-6-carboxamide |
| SMILES | CC1(C)OB(c2ccc3oc(-c4ccc(CNC(=O)c5cnc6nccn6c5)cc4)nc3c2)OC1(C)C |
| InChI | InChI=1S/C27H26BN5O4/c1-26(2)27(3,4)37-28(36-26)20-9-10-22-21(13-20)32-24(35-22)18-7-5-17(6-8-18)14-30-23(34)19-15-31-25-29-11-12-33(25)16-19/h5-13,15-16H,14H2,1-4H3,(H,30,34) |
| InChIKey | RAKYFODAFQVCKI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|