C25H32BN5O4S — CID 170600824
[(E)-3-[methyl-[(1E,3Z)-5-oxo-2-[4-[(1-propan-2-ylpyrazol-3-yl)sulfanylcarbamoylamino]-2,3-dihydro-1H-inden-5-yl]penta-1,3-dienyl]amino]prop-1-enyl]boronic acid (PubChem CID 170600824) has the molecular formula C25H32BN5O4S and a molecular weight of 509.44 g/mol. Its IUPAC name is [(E)-3-[methyl-[(1E,3Z)-5-oxo-2-[4-[(1-propan-2-ylpyrazol-3-yl)sulfanylcarbamoylamino]-2,3-dihydro-1H-inden-5-yl]penta-1,3-dienyl]amino]prop-1-enyl]boronic acid.
| Compound Name | [(E)-3-[methyl-[(1E,3Z)-5-oxo-2-[4-[(1-propan-2-ylpyrazol-3-yl)sulfanylcarbamoylamino]-2,3-dihydro-1H-inden-5-yl]penta-1,3-dienyl]amino]prop-1-enyl]boronic acid |
|---|---|
| PubChem CID | 170600824 |
| Molecular Formula | C25H32BN5O4S |
| Molecular Weight | 509.44 g/mol |
| Exact Mass | 509.23 |
| IUPAC Name | [(E)-3-[methyl-[(1E,3Z)-5-oxo-2-[4-[(1-propan-2-ylpyrazol-3-yl)sulfanylcarbamoylamino]-2,3-dihydro-1H-inden-5-yl]penta-1,3-dienyl]amino]prop-1-enyl]boronic acid |
| SMILES | CC(C)n1ccc(SNC(=O)Nc2c(C(/C=C\C=O)=C/N(C)C/C=C/B(O)O)ccc3c2CCC3)n1 |
| InChI | InChI=1S/C25H32BN5O4S/c1-18(2)31-15-12-23(28-31)36-29-25(33)27-24-21-9-4-7-19(21)10-11-22(24)20(8-5-16-32)17-30(3)14-6-13-26(34)35/h5-6,8,10-13,15-18,34-35H,4,7,9,14H2,1-3H3,(H2,27,29,33)/b8-5-,13-6+,20-17+ |
| InChIKey | FBZOQHKAKIOVOB-GASDRLQJSA-N |
| XLogP | 3.38 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.44 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|