About 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten
2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten (PubChem CID 170601195) has the molecular formula C8H13N2W-
and a molecular weight of 321.05 g/mol. Its IUPAC name is 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten.
Molecular Properties
| Compound Name | 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten |
| PubChem CID | 170601195 |
| Molecular Formula | C8H13N2W- |
| Molecular Weight | 321.05 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten |
| SMILES | Cc1nc(C(C)C)[c-]n1C.[W] |
| InChI | InChI=1S/C8H13N2.W/c1-6(2)8-5-10(4)7(3)9-8;/h6H,1-4H3;/q-1; |
| InChIKey | GWQFEGUGCADKSJ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.05 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten?
The IUPAC name of 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten (CID 170601195) is 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten.
What is the SMILES notation for 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten?
The canonical SMILES for 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten is Cc1nc(C(C)C)[c-]n1C.[W].
What is the InChIKey of 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten?
The InChIKey is GWQFEGUGCADKSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N2.W/c1-6(2)8-5-10(4)7(3)9-8;/h6H,1-4H3;/q-1;.
What are the key properties of 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten?
2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten has a molecular weight of 321.05 g/mol, XLogP of 1.65, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5-propan-2-yl-4H-imidazol-4-ide;tungsten is sourced from PubChem (CID 170601195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).