C14H22N4O3S — CID 170601310
7-[5-(aminomethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-amine;propane-2,2-diol (PubChem CID 170601310) has the molecular formula C14H22N4O3S and a molecular weight of 326.42 g/mol. Its IUPAC name is 7-[5-(aminomethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-amine;propane-2,2-diol.
| Compound Name | 7-[5-(aminomethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-amine;propane-2,2-diol |
|---|---|
| PubChem CID | 170601310 |
| Molecular Formula | C14H22N4O3S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 7-[5-(aminomethyl)oxolan-2-yl]thieno[3,2-d]pyrimidin-4-amine;propane-2,2-diol |
| SMILES | CC(C)(O)O.NCC1CCC(c2csc3c(N)ncnc23)O1 |
| InChI | InChI=1S/C11H14N4OS.C3H8O2/c12-3-6-1-2-8(16-6)7-4-17-10-9(7)14-5-15-11(10)13;1-3(2,4)5/h4-6,8H,1-3,12H2,(H2,13,14,15);4-5H,1-2H3 |
| InChIKey | XUSUZUOPNPPWEA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 127.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|