C9H14FN — CID 170601452
4-fluoro-1-prop-1-en-2-yl-2,3,4,7-tetrahydroazepine (PubChem CID 170601452) has the molecular formula C9H14FN and a molecular weight of 155.22 g/mol. Its IUPAC name is 4-fluoro-1-prop-1-en-2-yl-2,3,4,7-tetrahydroazepine.
| Compound Name | 4-fluoro-1-prop-1-en-2-yl-2,3,4,7-tetrahydroazepine |
|---|---|
| PubChem CID | 170601452 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | 4-fluoro-1-prop-1-en-2-yl-2,3,4,7-tetrahydroazepine |
| SMILES | C=C(C)N1CC=CC(F)CC1 |
| InChI | InChI=1S/C9H14FN/c1-8(2)11-6-3-4-9(10)5-7-11/h3-4,9H,1,5-7H2,2H3 |
| InChIKey | BPRIWNATIWWONX-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|