About 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine
4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine (PubChem CID 170601736) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine.
Analyze 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine?
The IUPAC name of 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine (CID 170601736) is 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine.
What is the SMILES notation for 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine?
The canonical SMILES for 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine is C=C(C)N1CCC=C(F)CC1.
What is the InChIKey of 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine?
The InChIKey is QUHZUAREORJRRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14FN/c1-8(2)11-6-3-4-9(10)5-7-11/h4H,1,3,5-7H2,2H3.
What are the key properties of 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine?
4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine has a molecular weight of 155.22 g/mol, XLogP of 2.47, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1-prop-1-en-2-yl-2,3,6,7-tetrahydroazepine is sourced from PubChem (CID 170601736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).