C19H36N2 — CID 170601853
ethane;1-propan-2-yl-2,3-dihydroazepine;1-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 170601853) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is ethane;1-propan-2-yl-2,3-dihydroazepine;1-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | ethane;1-propan-2-yl-2,3-dihydroazepine;1-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 170601853 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | ethane;1-propan-2-yl-2,3-dihydroazepine;1-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC.CC(C)N1C=CC=CCC1.CC(C)N1CC=CCC1 |
| InChI | InChI=1S/C9H15N.C8H15N.C2H6/c1-9(2)10-7-5-3-4-6-8-10;1-8(2)9-6-4-3-5-7-9;1-2/h3-5,7,9H,6,8H2,1-2H3;3-4,8H,5-7H2,1-2H3;1-2H3 |
| InChIKey | CEIKEDAISHYABS-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|