About 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile
2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile (PubChem CID 170601939) has the molecular formula C9H13FN2
and a molecular weight of 168.21 g/mol. Its IUPAC name is 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile |
| PubChem CID | 170601939 |
| Molecular Formula | C9H13FN2 |
| Molecular Weight | 168.21 g/mol |
| Exact Mass | 168.11 |
| IUPAC Name | 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile |
| SMILES | CCN1CC(F)=CC(CC#N)C1 |
| InChI | InChI=1S/C9H13FN2/c1-2-12-6-8(3-4-11)5-9(10)7-12/h5,8H,2-3,6-7H2,1H3 |
| InChIKey | QBGAUSIKODUXKJ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile?
The IUPAC name of 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile (CID 170601939) is 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile.
What is the SMILES notation for 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile?
The canonical SMILES for 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile is CCN1CC(F)=CC(CC#N)C1.
What is the InChIKey of 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile?
The InChIKey is QBGAUSIKODUXKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13FN2/c1-2-12-6-8(3-4-11)5-9(10)7-12/h5,8H,2-3,6-7H2,1H3.
What are the key properties of 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile?
2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile has a molecular weight of 168.21 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-ethyl-5-fluoro-3,6-dihydro-2H-pyridin-3-yl)acetonitrile is sourced from PubChem (CID 170601939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).