About N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine
N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine (PubChem CID 170602036) has the molecular formula C14H32N2O
and a molecular weight of 244.42 g/mol. Its IUPAC name is N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine.
Molecular Properties
| Compound Name | N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine |
| PubChem CID | 170602036 |
| Molecular Formula | C14H32N2O |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.25 |
| IUPAC Name | N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine |
| SMILES | C=C(CC)NC(C)C.CC.CCC(=O)N(C)C |
| InChI | InChI=1S/C7H15N.C5H11NO.C2H6/c1-5-7(4)8-6(2)3;1-4-5(7)6(2)3;1-2/h6,8H,4-5H2,1-3H3;4H2,1-3H3;1-2H3 |
| InChIKey | KWWGFDQWRIUMJK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine?
The IUPAC name of N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine (CID 170602036) is N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine.
What is the SMILES notation for N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine?
The canonical SMILES for N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine is C=C(CC)NC(C)C.CC.CCC(=O)N(C)C.
What is the InChIKey of N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine?
The InChIKey is KWWGFDQWRIUMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N.C5H11NO.C2H6/c1-5-7(4)8-6(2)3;1-4-5(7)6(2)3;1-2/h6,8H,4-5H2,1-3H3;4H2,1-3H3;1-2H3.
What are the key properties of N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine?
N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine has a molecular weight of 244.42 g/mol, XLogP of 3.42, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylpropanamide;ethane;N-propan-2-ylbut-1-en-2-amine is sourced from PubChem (CID 170602036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).