About 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide
2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide (PubChem CID 170602915) has the molecular formula C21H22N4O4
and a molecular weight of 394.43 g/mol. Its IUPAC name is 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide.
Molecular Properties
| Compound Name | 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide |
| PubChem CID | 170602915 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide |
| SMILES | Cn1nc2ccc(OCc3ccccc3)cc2c1C(=O)NCCN1CCOC1=O |
| InChI | InChI=1S/C21H22N4O4/c1-24-19(20(26)22-9-10-25-11-12-28-21(25)27)17-13-16(7-8-18(17)23-24)29-14-15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3,(H,22,26) |
| InChIKey | CTPOJNHCWMGFFQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide?
The IUPAC name of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide (CID 170602915) is 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide.
What is the SMILES notation for 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide?
The canonical SMILES for 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide is Cn1nc2ccc(OCc3ccccc3)cc2c1C(=O)NCCN1CCOC1=O.
What is the InChIKey of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide?
The InChIKey is CTPOJNHCWMGFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N4O4/c1-24-19(20(26)22-9-10-25-11-12-28-21(25)27)17-13-16(7-8-18(17)23-24)29-14-15-5-3-2-4-6-15/h2-8,13H,9-12,14H2,1H3,(H,22,26).
What are the key properties of 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide?
2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide has a molecular weight of 394.43 g/mol, XLogP of 2.33, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-5-phenylmethoxyindazole-3-carboxamide is sourced from PubChem (CID 170602915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).