About 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane
1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane (PubChem CID 170603033) has the molecular formula C24H37NO5
and a molecular weight of 419.56 g/mol. Its IUPAC name is 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane.
Molecular Properties
| Compound Name | 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane |
| PubChem CID | 170603033 |
| Molecular Formula | C24H37NO5 |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.27 |
| IUPAC Name | 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane |
| SMILES | C1COCCN1.CCCOCCC.COc1ccc(Oc2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C14H14O3.C6H14O.C4H9NO/c1-15-11-3-7-13(8-4-11)17-14-9-5-12(16-2)6-10-14;1-3-5-7-6-4-2;1-3-6-4-2-5-1/h3-10H,1-2H3;3-6H2,1-2H3;5H,1-4H2 |
| InChIKey | LUJOEKRLRHAVDY-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane?
The IUPAC name of 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane (CID 170603033) is 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane.
What is the SMILES notation for 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane?
The canonical SMILES for 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane is C1COCCN1.CCCOCCC.COc1ccc(Oc2ccc(OC)cc2)cc1.
What is the InChIKey of 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane?
The InChIKey is LUJOEKRLRHAVDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O3.C6H14O.C4H9NO/c1-15-11-3-7-13(8-4-11)17-14-9-5-12(16-2)6-10-14;1-3-5-7-6-4-2;1-3-6-4-2-5-1/h3-10H,1-2H3;3-6H2,1-2H3;5H,1-4H2.
What are the key properties of 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane?
1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane has a molecular weight of 419.56 g/mol, XLogP of 4.93, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-(4-methoxyphenoxy)benzene;morpholine;1-propoxypropane is sourced from PubChem (CID 170603033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).