C20H15Cl3N2O3 — CID 170604819
6-[(6-chloro-3-pyridinyl)methyl]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid (PubChem CID 170604819) has the molecular formula C20H15Cl3N2O3 and a molecular weight of 437.71 g/mol. Its IUPAC name is 6-[(6-chloro-3-pyridinyl)methyl]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid.
| Compound Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 170604819 |
| Molecular Formula | C20H15Cl3N2O3 |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | 6-[(6-chloro-3-pyridinyl)methyl]-2-(3,4-dichlorophenyl)-1-ethyl-4-oxopyridine-3-carboxylic acid |
| SMILES | CCn1c(Cc2ccc(Cl)nc2)cc(=O)c(C(=O)O)c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C20H15Cl3N2O3/c1-2-25-13(7-11-3-6-17(23)24-10-11)9-16(26)18(20(27)28)19(25)12-4-5-14(21)15(22)8-12/h3-6,8-10H,2,7H2,1H3,(H,27,28) |
| InChIKey | JFBYXHZDKMNDMN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|