C20H25NO4 — CID 170605485
8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-10,15-dione (PubChem CID 170605485) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-10,15-dione.
| Compound Name | 8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-10,15-dione |
|---|---|
| PubChem CID | 170605485 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 8,18-dioxa-11-azatetracyclo[17.2.2.02,7.011,16]tricosa-2,4,6-triene-10,15-dione |
| SMILES | O=C1CCCN2C(=O)COc3ccccc3C3CCC(CC3)OCC12 |
| InChI | InChI=1S/C20H25NO4/c22-18-5-3-11-21-17(18)12-24-15-9-7-14(8-10-15)16-4-1-2-6-19(16)25-13-20(21)23/h1-2,4,6,14-15,17H,3,5,7-13H2 |
| InChIKey | DQBVMZRBCIXCGM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |