C23H31F3N2O6S — CID 170605651
[2-[4-[(8-methyl-2-oxo-4-oxa-1,8-diazaspiro[5.5]undecan-7-yl)methoxy]cyclohexyl]phenyl] trifluoromethanesulfonate (PubChem CID 170605651) has the molecular formula C23H31F3N2O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is [2-[4-[(8-methyl-2-oxo-4-oxa-1,8-diazaspiro[5.5]undecan-7-yl)methoxy]cyclohexyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [2-[4-[(8-methyl-2-oxo-4-oxa-1,8-diazaspiro[5.5]undecan-7-yl)methoxy]cyclohexyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 170605651 |
| Molecular Formula | C23H31F3N2O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | [2-[4-[(8-methyl-2-oxo-4-oxa-1,8-diazaspiro[5.5]undecan-7-yl)methoxy]cyclohexyl]phenyl] trifluoromethanesulfonate |
| SMILES | CN1CCCC2(COCC(=O)N2)C1COC1CCC(c2ccccc2OS(=O)(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C23H31F3N2O6S/c1-28-12-4-11-22(15-32-14-21(29)27-22)20(28)13-33-17-9-7-16(8-10-17)18-5-2-3-6-19(18)34-35(30,31)23(24,25)26/h2-3,5-6,16-17,20H,4,7-15H2,1H3,(H,27,29) |
| InChIKey | UPLSEPQEKGORRS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|