C34H45F2N5O4S — CID 170605931
1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-[[(Z)-3-[2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]ethoxy]ethylamino]hept-3-enyl]amino]ethanone;formic acid (PubChem CID 170605931) has the molecular formula C34H45F2N5O4S and a molecular weight of 657.83 g/mol. Its IUPAC name is 1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-[[(Z)-3-[2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]ethoxy]ethylamino]hept-3-enyl]amino]ethanone;formic acid.
| Compound Name | 1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-[[(Z)-3-[2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]ethoxy]ethylamino]hept-3-enyl]amino]ethanone;formic acid |
|---|---|
| PubChem CID | 170605931 |
| Molecular Formula | C34H45F2N5O4S |
| Molecular Weight | 657.83 g/mol |
| Exact Mass | 657.32 |
| IUPAC Name | 1-(5,6-difluoro-1,3-dihydroisoindol-2-yl)-2-[[(Z)-3-[2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfanylamino]ethoxy]ethylamino]hept-3-enyl]amino]ethanone;formic acid |
| SMILES | CCC/C=C(/CCNCC(=O)N1Cc2cc(F)c(F)cc2C1)NCCOCCNSc1cccc2c(N(C)C)cccc12.O=CO |
| InChI | InChI=1S/C33H43F2N5O2S.CH2O2/c1-4-5-8-26(13-14-36-21-33(41)40-22-24-19-29(34)30(35)20-25(24)23-40)37-15-17-42-18-16-38-43-32-12-7-9-27-28(32)10-6-11-31(27)39(2)3;2-1-3/h6-12,19-20,36-38H,4-5,13-18,21-23H2,1-3H3;1H,(H,2,3)/b26-8-; |
| InChIKey | JQGSQDKUMJALPD-QDNFVYMYSA-N |
| XLogP | 5.29 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.83 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|