C23H24ClFN4O3 — CID 170606303
4-[7-(4-chloro-3-fluorophenyl)-2-methyl-5-oxa-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-11-carbonyl]-3,3-dimethylpiperazin-2-one (PubChem CID 170606303) has the molecular formula C23H24ClFN4O3 and a molecular weight of 458.92 g/mol. Its IUPAC name is 4-[7-(4-chloro-3-fluorophenyl)-2-methyl-5-oxa-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-11-carbonyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[7-(4-chloro-3-fluorophenyl)-2-methyl-5-oxa-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-11-carbonyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 170606303 |
| Molecular Formula | C23H24ClFN4O3 |
| Molecular Weight | 458.92 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 4-[7-(4-chloro-3-fluorophenyl)-2-methyl-5-oxa-7,12-diazatricyclo[6.4.0.02,6]dodeca-1(8),9,11-triene-11-carbonyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC12CCOC1N(c1ccc(Cl)c(F)c1)c1ccc(C(=O)N3CCNC(=O)C3(C)C)nc12 |
| InChI | InChI=1S/C23H24ClFN4O3/c1-22(2)20(31)26-9-10-28(22)19(30)16-6-7-17-18(27-16)23(3)8-11-32-21(23)29(17)13-4-5-14(24)15(25)12-13/h4-7,12,21H,8-11H2,1-3H3,(H,26,31) |
| InChIKey | IBRGRTILJNSHEE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.92 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |