About 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine
2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine (PubChem CID 170606653) has the molecular formula C10H18F2N2O2
and a molecular weight of 236.26 g/mol. Its IUPAC name is 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine.
Molecular Properties
| Compound Name | 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine |
| PubChem CID | 170606653 |
| Molecular Formula | C10H18F2N2O2 |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine |
| SMILES | CN1CCOC(COC2CNCC2(F)F)C1 |
| InChI | InChI=1S/C10H18F2N2O2/c1-14-2-3-15-8(5-14)6-16-9-4-13-7-10(9,11)12/h8-9,13H,2-7H2,1H3 |
| InChIKey | XVGUZCPCHNTLBW-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine?
The IUPAC name of 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine (CID 170606653) is 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine.
What is the SMILES notation for 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine?
The canonical SMILES for 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine is CN1CCOC(COC2CNCC2(F)F)C1.
What is the InChIKey of 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine?
The InChIKey is XVGUZCPCHNTLBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18F2N2O2/c1-14-2-3-15-8(5-14)6-16-9-4-13-7-10(9,11)12/h8-9,13H,2-7H2,1H3.
What are the key properties of 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine?
2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine has a molecular weight of 236.26 g/mol, XLogP of -0.06, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-difluoropyrrolidin-3-yl)oxymethyl]-4-methylmorpholine is sourced from PubChem (CID 170606653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).