About 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane
4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane (PubChem CID 170606693) has the molecular formula C16H34F2N2O2
and a molecular weight of 324.46 g/mol. Its IUPAC name is 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane.
Molecular Properties
| Compound Name | 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane |
| PubChem CID | 170606693 |
| Molecular Formula | C16H34F2N2O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane |
| SMILES | CC.CCC.CN1CC(OCCN2CCOCC2)C(F)(F)C1 |
| InChI | InChI=1S/C11H20F2N2O2.C3H8.C2H6/c1-14-8-10(11(12,13)9-14)17-7-4-15-2-5-16-6-3-15;1-3-2;1-2/h10H,2-9H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | YDTJYFVWDSLOQB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane?
The IUPAC name of 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane (CID 170606693) is 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane.
What is the SMILES notation for 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane?
The canonical SMILES for 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane is CC.CCC.CN1CC(OCCN2CCOCC2)C(F)(F)C1.
What is the InChIKey of 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane?
The InChIKey is YDTJYFVWDSLOQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F2N2O2.C3H8.C2H6/c1-14-8-10(11(12,13)9-14)17-7-4-15-2-5-16-6-3-15;1-3-2;1-2/h10H,2-9H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane?
4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane has a molecular weight of 324.46 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4,4-difluoro-1-methylpyrrolidin-3-yl)oxyethyl]morpholine;ethane;propane is sourced from PubChem (CID 170606693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).