About ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane
ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane (PubChem CID 170606813) has the molecular formula C18H37F3N2O
and a molecular weight of 354.50 g/mol. Its IUPAC name is ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane.
Molecular Properties
| Compound Name | ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane |
| PubChem CID | 170606813 |
| Molecular Formula | C18H37F3N2O |
| Molecular Weight | 354.50 g/mol |
| Exact Mass | 354.29 |
| IUPAC Name | ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane |
| SMILES | CC.CCC.CN1CCC(OCCN2CCC(C(F)(F)F)CC2)C1 |
| InChI | InChI=1S/C13H23F3N2O.C3H8.C2H6/c1-17-5-4-12(10-17)19-9-8-18-6-2-11(3-7-18)13(14,15)16;1-3-2;1-2/h11-12H,2-10H2,1H3;3H2,1-2H3;1-2H3 |
| InChIKey | IWVULXWCNFIDTB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.50 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane?
The IUPAC name of ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane (CID 170606813) is ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane.
What is the SMILES notation for ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane?
The canonical SMILES for ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane is CC.CCC.CN1CCC(OCCN2CCC(C(F)(F)F)CC2)C1.
What is the InChIKey of ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane?
The InChIKey is IWVULXWCNFIDTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23F3N2O.C3H8.C2H6/c1-17-5-4-12(10-17)19-9-8-18-6-2-11(3-7-18)13(14,15)16;1-3-2;1-2/h11-12H,2-10H2,1H3;3H2,1-2H3;1-2H3.
What are the key properties of ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane?
ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane has a molecular weight of 354.50 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-[2-(1-methylpyrrolidin-3-yl)oxyethyl]-4-(trifluoromethyl)piperidine;propane is sourced from PubChem (CID 170606813), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).