C25H44N2O5S — CID 170606981
2-[[(4R)-4-[(1R,3aS,3bS,5aS,9aR,9bS,11aR)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]pentanoyl]amino]ethanesulfonic acid (PubChem CID 170606981) has the molecular formula C25H44N2O5S and a molecular weight of 484.70 g/mol. Its IUPAC name is 2-[[(4R)-4-[(1R,3aS,3bS,5aS,9aR,9bS,11aR)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]pentanoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[(4R)-4-[(1R,3aS,3bS,5aS,9aR,9bS,11aR)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]pentanoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 170606981 |
| Molecular Formula | C25H44N2O5S |
| Molecular Weight | 484.70 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | 2-[[(4R)-4-[(1R,3aS,3bS,5aS,9aR,9bS,11aR)-4-hydroxy-9a,11a-dimethyl-2,3,3a,3b,4,5,5a,6,7,8,9,9b,10,11-tetradecahydro-1H-indeno[5,4-f]isoquinolin-1-yl]pentanoyl]amino]ethanesulfonic acid |
| SMILES | C[C@H](CCC(=O)NCCS(=O)(=O)O)[C@H]1CC[C@H]2[C@@H]3C(O)C[C@@H]4CNCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H44N2O5S/c1-16(4-7-22(29)27-12-13-33(30,31)32)18-5-6-19-23-20(8-9-25(18,19)3)24(2)10-11-26-15-17(24)14-21(23)28/h16-21,23,26,28H,4-15H2,1-3H3,(H,27,29)(H,30,31,32)/t16-,17-,18-,19+,20+,21?,23+,24+,25-/m1/s1 |
| InChIKey | IYVYMBYQSGJONS-QUGGYAEGSA-N |
| XLogP | 2.85 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.70 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|