About 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid
2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid (PubChem CID 170607219) has the molecular formula C16H21Cl2N3O4
and a molecular weight of 390.27 g/mol. Its IUPAC name is 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid |
| PubChem CID | 170607219 |
| Molecular Formula | C16H21Cl2N3O4 |
| Molecular Weight | 390.27 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid |
| SMILES | N[C@@H](CC1CCN(CC(=O)O)CC1)C(=O)OCc1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C16H21Cl2N3O4/c17-13-6-11(7-14(18)20-13)9-25-16(24)12(19)5-10-1-3-21(4-2-10)8-15(22)23/h6-7,10,12H,1-5,8-9,19H2,(H,22,23)/t12-/m0/s1 |
| InChIKey | DKPWKFJYTPNBKD-LBPRGKRZSA-N |
| XLogP | 1.95 |
| TPSA | 105.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.27 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid?
The IUPAC name of 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid (CID 170607219) is 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid.
What is the SMILES notation for 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid?
The canonical SMILES for 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid is N[C@@H](CC1CCN(CC(=O)O)CC1)C(=O)OCc1cc(Cl)nc(Cl)c1.
What is the InChIKey of 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid?
The InChIKey is DKPWKFJYTPNBKD-LBPRGKRZSA-N. The full InChI is InChI=1S/C16H21Cl2N3O4/c17-13-6-11(7-14(18)20-13)9-25-16(24)12(19)5-10-1-3-21(4-2-10)8-15(22)23/h6-7,10,12H,1-5,8-9,19H2,(H,22,23)/t12-/m0/s1.
What are the key properties of 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid?
2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid has a molecular weight of 390.27 g/mol, XLogP of 1.95, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[(2S)-2-amino-3-[(2,6-dichloro-4-pyridinyl)methoxy]-3-oxopropyl]piperidin-1-yl]acetic acid is sourced from PubChem (CID 170607219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).