C17H37N — CID 170608342
1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;ethane (PubChem CID 170608342) has the molecular formula C17H37N and a molecular weight of 255.49 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;ethane.
| Compound Name | 1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;ethane |
|---|---|
| PubChem CID | 170608342 |
| Molecular Formula | C17H37N |
| Molecular Weight | 255.49 g/mol |
| Exact Mass | 255.29 |
| IUPAC Name | 1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;ethane |
| SMILES | CC.CC.CC(C)C1CCN(CC2CCC2)CC1 |
| InChI | InChI=1S/C13H25N.2C2H6/c1-11(2)13-6-8-14(9-7-13)10-12-4-3-5-12;2*1-2/h11-13H,3-10H2,1-2H3;2*1-2H3 |
| InChIKey | BXABDTXWTIVBFC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |