C18H18O3 — CID 170609320
6-hydroxy-2,4,5,7,9-pentamethylxanthen-3-one (PubChem CID 170609320) has the molecular formula C18H18O3 and a molecular weight of 282.34 g/mol. Its IUPAC name is 6-hydroxy-2,4,5,7,9-pentamethylxanthen-3-one.
| Compound Name | 6-hydroxy-2,4,5,7,9-pentamethylxanthen-3-one |
|---|---|
| PubChem CID | 170609320 |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 6-hydroxy-2,4,5,7,9-pentamethylxanthen-3-one |
| SMILES | Cc1cc2c(C)c3cc(C)c(=O)c(C)c-3oc2c(C)c1O |
| InChI | InChI=1S/C18H18O3/c1-8-6-13-10(3)14-7-9(2)16(20)12(5)18(14)21-17(13)11(4)15(8)19/h6-7,19H,1-5H3 |
| InChIKey | QONOAMLMSWVCRN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|