C37H43FN2O6 — CID 170609672
(4R,8S)-1-amino-6-[3-[(3-aminophenyl)methoxy]-2-fluoro-6-methylphenyl]-11-hydroxy-9,13-dimethyl-8-propanoyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one (PubChem CID 170609672) has the molecular formula C37H43FN2O6 and a molecular weight of 630.76 g/mol. Its IUPAC name is (4R,8S)-1-amino-6-[3-[(3-aminophenyl)methoxy]-2-fluoro-6-methylphenyl]-11-hydroxy-9,13-dimethyl-8-propanoyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one.
| Compound Name | (4R,8S)-1-amino-6-[3-[(3-aminophenyl)methoxy]-2-fluoro-6-methylphenyl]-11-hydroxy-9,13-dimethyl-8-propanoyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
|---|---|
| PubChem CID | 170609672 |
| Molecular Formula | C37H43FN2O6 |
| Molecular Weight | 630.76 g/mol |
| Exact Mass | 630.31 |
| IUPAC Name | (4R,8S)-1-amino-6-[3-[(3-aminophenyl)methoxy]-2-fluoro-6-methylphenyl]-11-hydroxy-9,13-dimethyl-8-propanoyl-5,7-dioxapentacyclo[10.8.0.02,9.04,8.013,18]icosa-14,17-dien-16-one |
| SMILES | CCC(=O)[C@@]12OC(c3c(C)ccc(OCc4cccc(N)c4)c3F)O[C@@H]1CC1C3(N)CCC4=CC(=O)C=CC4(C)C3C(O)CC12C |
| InChI | InChI=1S/C37H43FN2O6/c1-5-28(43)37-29(45-33(46-37)30-20(2)9-10-26(31(30)38)44-19-21-7-6-8-23(39)15-21)17-27-35(37,4)18-25(42)32-34(3)13-12-24(41)16-22(34)11-14-36(27,32)40/h6-10,12-13,15-16,25,27,29,32-33,42H,5,11,14,17-19,39-40H2,1-4H3/t25?,27?,29-,32?,33?,34?,35?,36?,37-/m1/s1 |
| InChIKey | OJYXHWNSIONVIY-DBPKLUNYSA-N |
| XLogP | 5.40 |
| TPSA | 134.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.76 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|