C35H32N6O4 — CID 170609757
7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(4-nitro-1H-indol-3-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole (PubChem CID 170609757) has the molecular formula C35H32N6O4 and a molecular weight of 600.68 g/mol. Its IUPAC name is 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(4-nitro-1H-indol-3-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole.
| Compound Name | 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(4-nitro-1H-indol-3-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole |
|---|---|
| PubChem CID | 170609757 |
| Molecular Formula | C35H32N6O4 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 7-methoxy-1-[3-(7-methoxy-4,9-dihydro-3H-pyrido[3,4-b]indol-1-yl)-2-(4-nitro-1H-indol-3-yl)propyl]-4,9-dihydro-3H-pyrido[3,4-b]indole |
| SMILES | COc1ccc2c3c([nH]c2c1)C(CC(CC1=NCCc2c1[nH]c1cc(OC)ccc21)c1c[nH]c2cccc([N+](=O)[O-])c12)=NCC3 |
| InChI | InChI=1S/C35H32N6O4/c1-44-20-6-8-22-24-10-12-36-30(34(24)39-28(22)16-20)14-19(26-18-38-27-4-3-5-32(33(26)27)41(42)43)15-31-35-25(11-13-37-31)23-9-7-21(45-2)17-29(23)40-35/h3-9,16-19,38-40H,10-15H2,1-2H3 |
| InChIKey | AWGYMHBPROAEAB-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 133.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|