C24H35Cl2N7O2Si — CID 170610171
2-[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-1-yl]-1,2-dihydrotriazol-3-yl]ethanol (PubChem CID 170610171) has the molecular formula C24H35Cl2N7O2Si and a molecular weight of 552.58 g/mol. Its IUPAC name is 2-[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-1-yl]-1,2-dihydrotriazol-3-yl]ethanol.
| Compound Name | 2-[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-1-yl]-1,2-dihydrotriazol-3-yl]ethanol |
|---|---|
| PubChem CID | 170610171 |
| Molecular Formula | C24H35Cl2N7O2Si |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 551.20 |
| IUPAC Name | 2-[5-[4-[3-[tert-butyl(dimethyl)silyl]oxypropylamino]-6,7-dichloro-3-(1H-pyrazol-4-yl)indol-1-yl]-1,2-dihydrotriazol-3-yl]ethanol |
| SMILES | CC(C)(C)[Si](C)(C)OCCCNc1cc(Cl)c(Cl)c2c1c(-c1cn[nH]c1)cn2C1=CN(CCO)NN1 |
| InChI | InChI=1S/C24H35Cl2N7O2Si/c1-24(2,3)36(4,5)35-10-6-7-27-19-11-18(25)22(26)23-21(19)17(16-12-28-29-13-16)14-33(23)20-15-32(8-9-34)31-30-20/h11-15,27,30-31,34H,6-10H2,1-5H3,(H,28,29) |
| InChIKey | JNMQDISIVZQJKY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|