C19H24O4 — CID 170610378
6-ethyl-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoic acid (PubChem CID 170610378) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-ethyl-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoic acid.
| Compound Name | 6-ethyl-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoic acid |
|---|---|
| PubChem CID | 170610378 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 6-ethyl-2,4-dihydroxy-3-[(1R,6R)-3-methyl-6-prop-1-en-2-ylcyclohex-2-en-1-yl]benzoic acid |
| SMILES | C=C(C)[C@@H]1CCC(C)=C[C@H]1c1c(O)cc(CC)c(C(=O)O)c1O |
| InChI | InChI=1S/C19H24O4/c1-5-12-9-15(20)17(18(21)16(12)19(22)23)14-8-11(4)6-7-13(14)10(2)3/h8-9,13-14,20-21H,2,5-7H2,1,3-4H3,(H,22,23)/t13-,14+/m0/s1 |
| InChIKey | JBKIQPGMCRATFT-UONOGXRCSA-N |
| XLogP | 4.37 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|