C26H29N7 — CID 170610446
N-ethyl-N'-methyl-2-[1-[4-(9,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),8,10,12,15-hexaen-8-yl)phenyl]ethenylamino]ethanimidamide (PubChem CID 170610446) has the molecular formula C26H29N7 and a molecular weight of 439.57 g/mol. Its IUPAC name is N-ethyl-N'-methyl-2-[1-[4-(9,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),8,10,12,15-hexaen-8-yl)phenyl]ethenylamino]ethanimidamide.
| Compound Name | N-ethyl-N'-methyl-2-[1-[4-(9,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),8,10,12,15-hexaen-8-yl)phenyl]ethenylamino]ethanimidamide |
|---|---|
| PubChem CID | 170610446 |
| Molecular Formula | C26H29N7 |
| Molecular Weight | 439.57 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-ethyl-N'-methyl-2-[1-[4-(9,12,14,15-tetrazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),8,10,12,15-hexaen-8-yl)phenyl]ethenylamino]ethanimidamide |
| SMILES | C=C(NC/C(=N/C)NCC)c1ccc(-c2nc3cnc4[nH]ncc4c3c3c2CCCC3)cc1 |
| InChI | InChI=1S/C26H29N7/c1-4-28-23(27-3)15-29-16(2)17-9-11-18(12-10-17)25-20-8-6-5-7-19(20)24-21-13-31-33-26(21)30-14-22(24)32-25/h9-14,29H,2,4-8,15H2,1,3H3,(H,27,28)(H,30,31,33) |
| InChIKey | PCKQGMBADWCRCK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 90.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|