C26H31N3O — CID 170610536
4-(3-amino-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-9-yl)-N-(cyclopropylmethyl)benzamide;molecular hydrogen (PubChem CID 170610536) has the molecular formula C26H31N3O and a molecular weight of 401.55 g/mol. Its IUPAC name is 4-(3-amino-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-9-yl)-N-(cyclopropylmethyl)benzamide;molecular hydrogen.
| Compound Name | 4-(3-amino-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-9-yl)-N-(cyclopropylmethyl)benzamide;molecular hydrogen |
|---|---|
| PubChem CID | 170610536 |
| Molecular Formula | C26H31N3O |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | 4-(3-amino-4-methanimidoyl-5,6,7,8-tetrahydrophenanthren-9-yl)-N-(cyclopropylmethyl)benzamide;molecular hydrogen |
| SMILES | [H]/N=C/c1c(N)ccc2cc(-c3ccc(C(=O)NCC4CC4)cc3)c3c(c12)CCCC3.[H][H].[H][H] |
| InChI | InChI=1S/C26H27N3O.2H2/c27-14-23-24(28)12-11-19-13-22(20-3-1-2-4-21(20)25(19)23)17-7-9-18(10-8-17)26(30)29-15-16-5-6-16;;/h7-14,16,27H,1-6,15,28H2,(H,29,30);2*1H/b27-14+;; |
| InChIKey | IMVGGGUCWSHXAY-VCAXXXSPSA-N |
| XLogP | 5.60 |
| TPSA | 78.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|