About CID 170611503
CID 170611503 (PubChem CID 170611503) has the molecular formula C15H22BFN3O2+
and a molecular weight of 306.17 g/mol.
Molecular Properties
| Compound Name | CID 170611503 |
| PubChem CID | 170611503 |
| Molecular Formula | C15H22BFN3O2+ |
| Molecular Weight | 306.17 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | — |
| SMILES | [B]c1cc(F)cc(N)c1C(=[NH2+])CCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H21BFN3O2/c1-15(2,3)22-14(21)20-6-4-5-11(18)13-10(16)7-9(17)8-12(13)19/h7-8,18H,4-6,19H2,1-3H3,(H,20,21)/p+1 |
| InChIKey | XNAGIOXCASRFDI-UHFFFAOYSA-O |
| XLogP | 0.05 |
| TPSA | 89.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.17 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze CID 170611503 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 170611503?
The IUPAC name of CID 170611503 (CID 170611503) is not available.
What is the SMILES notation for CID 170611503?
The canonical SMILES for CID 170611503 is [B]c1cc(F)cc(N)c1C(=[NH2+])CCCNC(=O)OC(C)(C)C.
What is the InChIKey of CID 170611503?
The InChIKey is XNAGIOXCASRFDI-UHFFFAOYSA-O. The full InChI is InChI=1S/C15H21BFN3O2/c1-15(2,3)22-14(21)20-6-4-5-11(18)13-10(16)7-9(17)8-12(13)19/h7-8,18H,4-6,19H2,1-3H3,(H,20,21)/p+1.
What are the key properties of CID 170611503?
CID 170611503 has a molecular weight of 306.17 g/mol, XLogP of 0.05, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 170611503 is sourced from PubChem (CID 170611503), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).