C24H31F3N2O2 — CID 170611587
(3S,6R,7aR,11aR)-3-propan-2-yl-6-prop-2-enyl-9-[[4-(trifluoromethyl)phenyl]methyl]-2,3,6,7,7a,8,10,11-octahydro-[1,3]oxazolo[2,3-j][1,6]naphthyridin-5-one (PubChem CID 170611587) has the molecular formula C24H31F3N2O2 and a molecular weight of 436.52 g/mol. Its IUPAC name is (3S,6R,7aR,11aR)-3-propan-2-yl-6-prop-2-enyl-9-[[4-(trifluoromethyl)phenyl]methyl]-2,3,6,7,7a,8,10,11-octahydro-[1,3]oxazolo[2,3-j][1,6]naphthyridin-5-one.
| Compound Name | (3S,6R,7aR,11aR)-3-propan-2-yl-6-prop-2-enyl-9-[[4-(trifluoromethyl)phenyl]methyl]-2,3,6,7,7a,8,10,11-octahydro-[1,3]oxazolo[2,3-j][1,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 170611587 |
| Molecular Formula | C24H31F3N2O2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | (3S,6R,7aR,11aR)-3-propan-2-yl-6-prop-2-enyl-9-[[4-(trifluoromethyl)phenyl]methyl]-2,3,6,7,7a,8,10,11-octahydro-[1,3]oxazolo[2,3-j][1,6]naphthyridin-5-one |
| SMILES | C=CC[C@@H]1C[C@@H]2CN(Cc3ccc(C(F)(F)F)cc3)CC[C@@]23OC[C@H](C(C)C)N3C1=O |
| InChI | InChI=1S/C24H31F3N2O2/c1-4-5-18-12-20-14-28(13-17-6-8-19(9-7-17)24(25,26)27)11-10-23(20)29(22(18)30)21(15-31-23)16(2)3/h4,6-9,16,18,20-21H,1,5,10-15H2,2-3H3/t18-,20-,21-,23-/m1/s1 |
| InChIKey | UIECTSDWTXMUQQ-KTDPBYDISA-N |
| XLogP | 4.70 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|