C11H16N2O — CID 170611768
ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine (PubChem CID 170611768) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine.
| Compound Name | ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 170611768 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine |
| SMILES | CC.COc1cc2cc(C)[nH]c2cn1 |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-6-3-7-4-9(12-2)10-5-8(7)11-6;1-2/h3-5,11H,1-2H3;1-2H3 |
| InChIKey | CMUDBTOEPAXVRQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |