About ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine
ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine (PubChem CID 170611768) has the molecular formula C11H16N2O
and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine.
Molecular Properties
| Compound Name | ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine |
| PubChem CID | 170611768 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine |
| SMILES | CC.COc1cc2cc(C)[nH]c2cn1 |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-6-3-7-4-9(12-2)10-5-8(7)11-6;1-2/h3-5,11H,1-2H3;1-2H3 |
| InChIKey | CMUDBTOEPAXVRQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine?
The IUPAC name of ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine (CID 170611768) is ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine.
What is the SMILES notation for ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine?
The canonical SMILES for ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine is CC.COc1cc2cc(C)[nH]c2cn1.
What is the InChIKey of ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine?
The InChIKey is CMUDBTOEPAXVRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O.C2H6/c1-6-3-7-4-9(12-2)10-5-8(7)11-6;1-2/h3-5,11H,1-2H3;1-2H3.
What are the key properties of ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine?
ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine has a molecular weight of 192.26 g/mol, XLogP of 2.91, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-methoxy-2-methyl-1H-pyrrolo[2,3-c]pyridine is sourced from PubChem (CID 170611768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).