C13H29N2O3+ — CID 170612923
dimethyl-[2-[2-[3-(2-methylpropylamino)-3-oxopropoxy]ethoxy]ethyl]azanium (PubChem CID 170612923) has the molecular formula C13H29N2O3+ and a molecular weight of 261.39 g/mol. Its IUPAC name is dimethyl-[2-[2-[3-(2-methylpropylamino)-3-oxopropoxy]ethoxy]ethyl]azanium.
| Compound Name | dimethyl-[2-[2-[3-(2-methylpropylamino)-3-oxopropoxy]ethoxy]ethyl]azanium |
|---|---|
| PubChem CID | 170612923 |
| Molecular Formula | C13H29N2O3+ |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.22 |
| IUPAC Name | dimethyl-[2-[2-[3-(2-methylpropylamino)-3-oxopropoxy]ethoxy]ethyl]azanium |
| SMILES | CC(C)CNC(=O)CCOCCOCC[NH+](C)C |
| InChI | InChI=1S/C13H28N2O3/c1-12(2)11-14-13(16)5-7-17-9-10-18-8-6-15(3)4/h12H,5-11H2,1-4H3,(H,14,16)/p+1 |
| InChIKey | RHPBPZWZEUSIGL-UHFFFAOYSA-O |
| XLogP | -0.67 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|