C17H33N3O3 — CID 170613139
tert-butyl 4-[3,3-dimethyl-4-(methylamino)-5-oxopentyl]piperazine-1-carboxylate (PubChem CID 170613139) has the molecular formula C17H33N3O3 and a molecular weight of 327.47 g/mol. Its IUPAC name is tert-butyl 4-[3,3-dimethyl-4-(methylamino)-5-oxopentyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3,3-dimethyl-4-(methylamino)-5-oxopentyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 170613139 |
| Molecular Formula | C17H33N3O3 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.25 |
| IUPAC Name | tert-butyl 4-[3,3-dimethyl-4-(methylamino)-5-oxopentyl]piperazine-1-carboxylate |
| SMILES | CNC(C=O)C(C)(C)CCN1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C17H33N3O3/c1-16(2,3)23-15(22)20-11-9-19(10-12-20)8-7-17(4,5)14(13-21)18-6/h13-14,18H,7-12H2,1-6H3 |
| InChIKey | JZAWARSXGGACEY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|