C10H17F2N — CID 170613360
6-(difluoromethyl)-4-methyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine (PubChem CID 170613360) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-methyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-(difluoromethyl)-4-methyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 170613360 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 6-(difluoromethyl)-4-methyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CC1=C(C(C)C)C(C(F)F)NCC1 |
| InChI | InChI=1S/C10H17F2N/c1-6(2)8-7(3)4-5-13-9(8)10(11)12/h6,9-10,13H,4-5H2,1-3H3 |
| InChIKey | GFZFGBZSAQGLRJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|