C11H19F2N — CID 170613718
6-(difluoromethyl)-4-ethyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine (PubChem CID 170613718) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-ethyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine.
| Compound Name | 6-(difluoromethyl)-4-ethyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 170613718 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 6-(difluoromethyl)-4-ethyl-5-propan-2-yl-1,2,3,6-tetrahydropyridine |
| SMILES | CCC1=C(C(C)C)C(C(F)F)NCC1 |
| InChI | InChI=1S/C11H19F2N/c1-4-8-5-6-14-10(11(12)13)9(8)7(2)3/h7,10-11,14H,4-6H2,1-3H3 |
| InChIKey | GLGBOLXRULHMFF-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|